C22H29ClN6O2S — CID 14986690
4-chloro-N-[8-pyridin-3-yl-5-[2-(5H-tetrazol-5-yl)ethyl]octyl]benzenesulfonamide (PubChem CID 14986690) has the molecular formula C22H29ClN6O2S and a molecular weight of 477.03 g/mol. Its IUPAC name is 4-chloro-N-[8-pyridin-3-yl-5-[2-(5H-tetrazol-5-yl)ethyl]octyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[8-pyridin-3-yl-5-[2-(5H-tetrazol-5-yl)ethyl]octyl]benzenesulfonamide |
|---|---|
| PubChem CID | 14986690 |
| Molecular Formula | C22H29ClN6O2S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 4-chloro-N-[8-pyridin-3-yl-5-[2-(5H-tetrazol-5-yl)ethyl]octyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCC(CCCc1cccnc1)CCC1N=NN=N1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H29ClN6O2S/c23-20-10-12-21(13-11-20)32(30,31)25-16-2-1-5-18(9-14-22-26-28-29-27-22)6-3-7-19-8-4-15-24-17-19/h4,8,10-13,15,17-18,22,25H,1-3,5-7,9,14,16H2 |
| InChIKey | PLPCICZFWJDWCF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|