About 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate
2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate (PubChem CID 14986948) has the molecular formula C15H14ClN3O2
and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate.
Molecular Properties
| Compound Name | 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate |
| PubChem CID | 14986948 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate |
| SMILES | CC(=O)OCC(C)n1cnc2c(Cl)nc3ccccc3c21 |
| InChI | InChI=1S/C15H14ClN3O2/c1-9(7-21-10(2)20)19-8-17-13-14(19)11-5-3-4-6-12(11)18-15(13)16/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | PVFSVCLFBMYMLX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate?
The IUPAC name of 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate (CID 14986948) is 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate.
What is the SMILES notation for 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate?
The canonical SMILES for 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate is CC(=O)OCC(C)n1cnc2c(Cl)nc3ccccc3c21.
What is the InChIKey of 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate?
The InChIKey is PVFSVCLFBMYMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN3O2/c1-9(7-21-10(2)20)19-8-17-13-14(19)11-5-3-4-6-12(11)18-15(13)16/h3-6,8-9H,7H2,1-2H3.
What are the key properties of 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate?
2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate has a molecular weight of 303.75 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloroimidazo[4,5-c]quinolin-1-yl)propyl acetate is sourced from PubChem (CID 14986948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).