About Aloin B
Aloin B (PubChem CID 14989) has the molecular formula C21H22O9
and a molecular weight of 418.40 g/mol. Its IUPAC name is (10R)-1,8-dihydroxy-3-(hydroxymethyl)-10-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one.
Molecular Properties
| Compound Name | Aloin B |
| PubChem CID | 14989 |
| Molecular Formula | C21H22O9 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (10R)-1,8-dihydroxy-3-(hydroxymethyl)-10-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C([C@@H]2[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C=C(C=C3O)CO |
| InChI | InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13-,14-,17-,19+,20-,21+/m1/s1 |
| InChIKey | AFHJQYHRLPMKHU-WEZNYRQKSA-N |
| XLogP | -0.10 |
| TPSA | 168.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | 630 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze Aloin B with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Aloin B?
The IUPAC name of Aloin B (CID 14989) is (10R)-1,8-dihydroxy-3-(hydroxymethyl)-10-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one.
What is the SMILES notation for Aloin B?
The canonical SMILES for Aloin B is C1=CC2=C(C(=C1)O)C(=O)C3=C([C@@H]2[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C=C(C=C3O)CO.
What is the InChIKey of Aloin B?
The InChIKey is AFHJQYHRLPMKHU-WEZNYRQKSA-N. The full InChI is InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13-,14-,17-,19+,20-,21+/m1/s1.
What are the key properties of Aloin B?
Aloin B has a molecular weight of 418.40 g/mol, XLogP of -0.10, 3 rotatable bonds, 7 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for Aloin B is sourced from PubChem (CID 14989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).