About 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine
1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine (PubChem CID 14990529) has the molecular formula C21H31NO2
and a molecular weight of 329.48 g/mol. Its IUPAC name is 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine.
Molecular Properties
| Compound Name | 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine |
| PubChem CID | 14990529 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine |
| SMILES | c1ccc(C2CCC3(CC2)OCCC(CN2CCCCC2)O3)cc1 |
| InChI | InChI=1S/C21H31NO2/c1-3-7-18(8-4-1)19-9-12-21(13-10-19)23-16-11-20(24-21)17-22-14-5-2-6-15-22/h1,3-4,7-8,19-20H,2,5-6,9-17H2 |
| InChIKey | VTWFPMJLCQOIEK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine?
The IUPAC name of 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine (CID 14990529) is 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine.
What is the SMILES notation for 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine?
The canonical SMILES for 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine is c1ccc(C2CCC3(CC2)OCCC(CN2CCCCC2)O3)cc1.
What is the InChIKey of 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine?
The InChIKey is VTWFPMJLCQOIEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31NO2/c1-3-7-18(8-4-1)19-9-12-21(13-10-19)23-16-11-20(24-21)17-22-14-5-2-6-15-22/h1,3-4,7-8,19-20H,2,5-6,9-17H2.
What are the key properties of 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine?
1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine has a molecular weight of 329.48 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(9-phenyl-1,5-dioxaspiro[5.5]undecan-4-yl)methyl]piperidine is sourced from PubChem (CID 14990529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).