C26H26N4O5 — CID 14991353
(2S)-2-[[4-[(2-amino-4-methylquinolin-6-yl)methyl-prop-2-ynylamino]benzoyl]amino]pentanedioic acid (PubChem CID 14991353) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-methylquinolin-6-yl)methyl-prop-2-ynylamino]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-methylquinolin-6-yl)methyl-prop-2-ynylamino]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 14991353 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-methylquinolin-6-yl)methyl-prop-2-ynylamino]benzoyl]amino]pentanedioic acid |
| SMILES | C#CCN(Cc1ccc2nc(N)cc(C)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C26H26N4O5/c1-3-12-30(15-17-4-9-21-20(14-17)16(2)13-23(27)28-21)19-7-5-18(6-8-19)25(33)29-22(26(34)35)10-11-24(31)32/h1,4-9,13-14,22H,10-12,15H2,2H3,(H2,27,28)(H,29,33)(H,31,32)(H,34,35)/t22-/m0/s1 |
| InChIKey | IAQMHGMXJODOMU-QFIPXVFZSA-N |
| XLogP | 2.81 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|