C28H34O5SSi — CID 14991429
(2R,3S,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxane-3,4,5-triol (PubChem CID 14991429) has the molecular formula C28H34O5SSi and a molecular weight of 510.73 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 14991429 |
| Molecular Formula | C28H34O5SSi |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34O5SSi/c1-28(2,3)35(21-15-9-5-10-16-21,22-17-11-6-12-18-22)32-19-23-24(29)25(30)26(31)27(33-23)34-20-13-7-4-8-14-20/h4-18,23-27,29-31H,19H2,1-3H3/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | FGJINLMKPNLMAY-SEFGFODJSA-N |
| XLogP | 3.16 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|