About (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one
(5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one (PubChem CID 14991931) has the molecular formula C13H21ClO
and a molecular weight of 228.76 g/mol. Its IUPAC name is (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one.
Molecular Properties
| Compound Name | (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one |
| PubChem CID | 14991931 |
| Molecular Formula | C13H21ClO |
| Molecular Weight | 228.76 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one |
| SMILES | C=C(C)C(Cl)CC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C13H21ClO/c1-10(2)13(14)9-8-11(3)6-5-7-12(4)15/h6,13H,1,5,7-9H2,2-4H3/b11-6+ |
| InChIKey | BVOSBBHJUNPKTN-IZZDOVSWSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.76 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one?
The IUPAC name of (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one (CID 14991931) is (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one.
What is the SMILES notation for (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one?
The canonical SMILES for (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one is C=C(C)C(Cl)CC/C(C)=C/CCC(C)=O.
What is the InChIKey of (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one?
The InChIKey is BVOSBBHJUNPKTN-IZZDOVSWSA-N. The full InChI is InChI=1S/C13H21ClO/c1-10(2)13(14)9-8-11(3)6-5-7-12(4)15/h6,13H,1,5,7-9H2,2-4H3/b11-6+.
What are the key properties of (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one?
(5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one has a molecular weight of 228.76 g/mol, XLogP of 4.27, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-9-chloro-6,10-dimethylundeca-5,10-dien-2-one is sourced from PubChem (CID 14991931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).