C19H24O2 — CID 14992011
[3-ethyl-5-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)phenyl] acetate (PubChem CID 14992011) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is [3-ethyl-5-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)phenyl] acetate.
| Compound Name | [3-ethyl-5-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)phenyl] acetate |
|---|---|
| PubChem CID | 14992011 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | [3-ethyl-5-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)phenyl] acetate |
| SMILES | CCc1cc(OC(C)=O)cc(C2=C(C)C=CCC2(C)C)c1 |
| InChI | InChI=1S/C19H24O2/c1-6-15-10-16(12-17(11-15)21-14(3)20)18-13(2)8-7-9-19(18,4)5/h7-8,10-12H,6,9H2,1-5H3 |
| InChIKey | GXNXDZWGIGSTEE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|