About 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one
6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one (PubChem CID 1499203) has the molecular formula C9H10N4OS
and a molecular weight of 222.27 g/mol. Its IUPAC name is 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one |
| PubChem CID | 1499203 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one |
| SMILES | O=c1c2nnsc2ncn1C1CCCC1 |
| InChI | InChI=1S/C9H10N4OS/c14-9-7-8(15-12-11-7)10-5-13(9)6-3-1-2-4-6/h5-6H,1-4H2 |
| InChIKey | FKCNMRPPLQRJMN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one?
The IUPAC name of 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one (CID 1499203) is 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one.
What is the SMILES notation for 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one?
The canonical SMILES for 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one is O=c1c2nnsc2ncn1C1CCCC1.
What is the InChIKey of 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one?
The InChIKey is FKCNMRPPLQRJMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4OS/c14-9-7-8(15-12-11-7)10-5-13(9)6-3-1-2-4-6/h5-6H,1-4H2.
What are the key properties of 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one?
6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one has a molecular weight of 222.27 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopentylthiadiazolo[5,4-d]pyrimidin-7-one is sourced from PubChem (CID 1499203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).