C12H11FN4O2S — CID 1499206
5-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]thiadiazole-4-carboxamide (PubChem CID 1499206) has the molecular formula C12H11FN4O2S and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]thiadiazole-4-carboxamide.
| Compound Name | 5-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 1499206 |
| Molecular Formula | C12H11FN4O2S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]thiadiazole-4-carboxamide |
| SMILES | NC(=O)c1nnsc1CC(=O)NCc1ccccc1F |
| InChI | InChI=1S/C12H11FN4O2S/c13-8-4-2-1-3-7(8)6-15-10(18)5-9-11(12(14)19)16-17-20-9/h1-4H,5-6H2,(H2,14,19)(H,15,18) |
| InChIKey | YDEICCKEZHDYLK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |