C17H18INO4 — CID 14994254
dimethyl 4-(2-iodophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 14994254) has the molecular formula C17H18INO4 and a molecular weight of 427.24 g/mol. Its IUPAC name is dimethyl 4-(2-iodophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(2-iodophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14994254 |
| Molecular Formula | C17H18INO4 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | dimethyl 4-(2-iodophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccccc1I |
| InChI | InChI=1S/C17H18INO4/c1-9-13(16(20)22-3)15(11-7-5-6-8-12(11)18)14(10(2)19-9)17(21)23-4/h5-8,15,19H,1-4H3 |
| InChIKey | XKRZWVJRBBDIIK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|