1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid

C10H6F2N2O2 — CID 14994496

IUPAC1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid
SMILESO=C(O)c1cnn(-c2ccc(F)cc2F)c1
InChIInChI=1S/C10H6F2N2O2/c11-7-1-2-9(8(12)3-7)14-5-6(4-13-14)10(15)16/h1-5H,(H,15,16)
InChIKeyWJPQZDCOLISRIF-UHFFFAOYSA-N
MW224.17 g/mol
LogP1.85
Rot. Bonds2

About 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid

1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid (PubChem CID 14994496) has the molecular formula C10H6F2N2O2 and a molecular weight of 224.17 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid.

Molecular Properties

Compound Name1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid
PubChem CID14994496
Molecular FormulaC10H6F2N2O2
Molecular Weight224.17 g/mol
Exact Mass224.04
IUPAC Name1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid
SMILESO=C(O)c1cnn(-c2ccc(F)cc2F)c1
InChIInChI=1S/C10H6F2N2O2/c11-7-1-2-9(8(12)3-7)14-5-6(4-13-14)10(15)16/h1-5H,(H,15,16)
InChIKeyWJPQZDCOLISRIF-UHFFFAOYSA-N
XLogP1.85
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.17
LogP ≤ 51.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid?
The IUPAC name of 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid (CID 14994496) is 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid is O=C(O)c1cnn(-c2ccc(F)cc2F)c1.
What is the InChIKey of 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid?
The InChIKey is WJPQZDCOLISRIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N2O2/c11-7-1-2-9(8(12)3-7)14-5-6(4-13-14)10(15)16/h1-5H,(H,15,16).
What are the key properties of 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid?
1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid has a molecular weight of 224.17 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 14994496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).