About dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate
dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate (PubChem CID 14994874) has the molecular formula C16H14Cl2O5
and a molecular weight of 357.19 g/mol. Its IUPAC name is dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate |
| PubChem CID | 14994874 |
| Molecular Formula | C16H14Cl2O5 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(c3ccc(Cl)cc3Cl)CCC1O2 |
| InChI | InChI=1S/C16H14Cl2O5/c1-21-14(19)12-11-5-6-16(23-11,13(12)15(20)22-2)9-4-3-8(17)7-10(9)18/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | SEZQWSYYYAXMJS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
The IUPAC name of dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate (CID 14994874) is dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
The canonical SMILES for dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate is COC(=O)C1=C(C(=O)OC)C2(c3ccc(Cl)cc3Cl)CCC1O2.
What is the InChIKey of dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
The InChIKey is SEZQWSYYYAXMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2O5/c1-21-14(19)12-11-5-6-16(23-11,13(12)15(20)22-2)9-4-3-8(17)7-10(9)18/h3-4,7,11H,5-6H2,1-2H3.
What are the key properties of dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate has a molecular weight of 357.19 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-(2,4-dichlorophenyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate is sourced from PubChem (CID 14994874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).