C30H29ClNP — CID 14995198
4-[3-[[chloro(triphenyl)-lambda5-phosphanyl]methyl]phenyl]-2-methylbutanenitrile (PubChem CID 14995198) has the molecular formula C30H29ClNP and a molecular weight of 470.00 g/mol. Its IUPAC name is 4-[3-[[chloro(triphenyl)-lambda5-phosphanyl]methyl]phenyl]-2-methylbutanenitrile.
| Compound Name | 4-[3-[[chloro(triphenyl)-lambda5-phosphanyl]methyl]phenyl]-2-methylbutanenitrile |
|---|---|
| PubChem CID | 14995198 |
| Molecular Formula | C30H29ClNP |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 4-[3-[[chloro(triphenyl)-lambda5-phosphanyl]methyl]phenyl]-2-methylbutanenitrile |
| SMILES | CC(C#N)CCc1cccc(CP(Cl)(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C30H29ClNP/c1-25(23-32)20-21-26-12-11-13-27(22-26)24-33(31,28-14-5-2-6-15-28,29-16-7-3-8-17-29)30-18-9-4-10-19-30/h2-19,22,25H,20-21,24H2,1H3 |
| InChIKey | MCKVHFFEMGAPMT-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|