C23H23NO7 — CID 14996527
prop-2-enyl (5R,6S)-3-(4-formylphenyl)-7-oxo-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 14996527) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is prop-2-enyl (5R,6S)-3-(4-formylphenyl)-7-oxo-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | prop-2-enyl (5R,6S)-3-(4-formylphenyl)-7-oxo-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 14996527 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | prop-2-enyl (5R,6S)-3-(4-formylphenyl)-7-oxo-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C=CCOC(=O)O[C@H](C)[C@H]1C(=O)N2C(C(=O)OCC=C)=C(c3ccc(C=O)cc3)C[C@H]12 |
| InChI | InChI=1S/C23H23NO7/c1-4-10-29-22(27)20-17(16-8-6-15(13-25)7-9-16)12-18-19(21(26)24(18)20)14(3)31-23(28)30-11-5-2/h4-9,13-14,18-19H,1-2,10-12H2,3H3/t14-,18-,19-/m1/s1 |
| InChIKey | DUBWFRVHIZREKM-NIKGAXFTSA-N |
| XLogP | 2.90 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|