C27H26N4O5 — CID 14997027
(E)-3-[3-[[2-(N-[2-(N-methylanilino)-2-oxoethyl]anilino)-2-oxoethyl]carbamoylamino]phenyl]prop-2-enoic acid (PubChem CID 14997027) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is (E)-3-[3-[[2-(N-[2-(N-methylanilino)-2-oxoethyl]anilino)-2-oxoethyl]carbamoylamino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[2-(N-[2-(N-methylanilino)-2-oxoethyl]anilino)-2-oxoethyl]carbamoylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 14997027 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (E)-3-[3-[[2-(N-[2-(N-methylanilino)-2-oxoethyl]anilino)-2-oxoethyl]carbamoylamino]phenyl]prop-2-enoic acid |
| SMILES | CN(C(=O)CN(C(=O)CNC(=O)Nc1cccc(/C=C/C(=O)O)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N4O5/c1-30(22-11-4-2-5-12-22)25(33)19-31(23-13-6-3-7-14-23)24(32)18-28-27(36)29-21-10-8-9-20(17-21)15-16-26(34)35/h2-17H,18-19H2,1H3,(H,34,35)(H2,28,29,36)/b16-15+ |
| InChIKey | KJGGQSDBGXAMFS-FOCLMDBBSA-N |
| XLogP | 3.60 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|