C19H14FN3OS — CID 14997534
S-[4-(4-fluorophenyl)-2,5,7-triazatricyclo[6.5.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-3-yl] propanethioate (PubChem CID 14997534) has the molecular formula C19H14FN3OS and a molecular weight of 351.41 g/mol. Its IUPAC name is S-[4-(4-fluorophenyl)-2,5,7-triazatricyclo[6.5.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-3-yl] propanethioate.
| Compound Name | S-[4-(4-fluorophenyl)-2,5,7-triazatricyclo[6.5.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-3-yl] propanethioate |
|---|---|
| PubChem CID | 14997534 |
| Molecular Formula | C19H14FN3OS |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | S-[4-(4-fluorophenyl)-2,5,7-triazatricyclo[6.5.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-3-yl] propanethioate |
| SMILES | CCC(=O)Sc1c(-c2ccc(F)cc2)nc2nc3cccccc3n12 |
| InChI | InChI=1S/C19H14FN3OS/c1-2-16(24)25-18-17(12-8-10-13(20)11-9-12)22-19-21-14-6-4-3-5-7-15(14)23(18)19/h3-11H,2H2,1H3 |
| InChIKey | UZCAIOKRZBFUHG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|