About S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate
S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate (PubChem CID 14997565) has the molecular formula C19H17N3OS
and a molecular weight of 335.43 g/mol. Its IUPAC name is S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate.
Molecular Properties
| Compound Name | S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate |
| PubChem CID | 14997565 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate |
| SMILES | CCC(=O)Sc1c(-c2ccccc2)nc2n(C)c3ccccc3n12 |
| InChI | InChI=1S/C19H17N3OS/c1-3-16(23)24-18-17(13-9-5-4-6-10-13)20-19-21(2)14-11-7-8-12-15(14)22(18)19/h4-12H,3H2,1-2H3 |
| InChIKey | ATBURXMFLZBGHM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate?
The IUPAC name of S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate (CID 14997565) is S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate.
What is the SMILES notation for S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate?
The canonical SMILES for S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate is CCC(=O)Sc1c(-c2ccccc2)nc2n(C)c3ccccc3n12.
What is the InChIKey of S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate?
The InChIKey is ATBURXMFLZBGHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3OS/c1-3-16(23)24-18-17(13-9-5-4-6-10-13)20-19-21(2)14-11-7-8-12-15(14)22(18)19/h4-12H,3H2,1-2H3.
What are the key properties of S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate?
S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate has a molecular weight of 335.43 g/mol, XLogP of 4.52, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl) propanethioate is sourced from PubChem (CID 14997565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).