About diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride
diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride (PubChem CID 14998) has the molecular formula C22H30ClNO3
and a molecular weight of 391.94 g/mol. Its IUPAC name is diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride.
Molecular Properties
| Compound Name | diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride |
| PubChem CID | 14998 |
| Molecular Formula | C22H30ClNO3 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride |
| SMILES | CC[NH+](CC)C(C)COC(=O)C(OC)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H29NO3.ClH/c1-5-23(6-2)18(3)17-26-21(24)22(25-4,19-13-9-7-10-14-19)20-15-11-8-12-16-20;/h7-16,18H,5-6,17H2,1-4H3;1H |
| InChIKey | NKGAKOCTNMVFCZ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride?
The IUPAC name of diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride (CID 14998) is diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride.
What is the SMILES notation for diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride?
The canonical SMILES for diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride is CC[NH+](CC)C(C)COC(=O)C(OC)(c1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride?
The InChIKey is NKGAKOCTNMVFCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO3.ClH/c1-5-23(6-2)18(3)17-26-21(24)22(25-4,19-13-9-7-10-14-19)20-15-11-8-12-16-20;/h7-16,18H,5-6,17H2,1-4H3;1H.
What are the key properties of diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride?
diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride has a molecular weight of 391.94 g/mol, XLogP of -0.56, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-[1-(2-methoxy-2,2-diphenylacetyl)oxypropan-2-yl]azanium chloride is sourced from PubChem (CID 14998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).