C8H9F3N2O2 — CID 14998085
1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carbaldehyde (PubChem CID 14998085) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carbaldehyde.
| Compound Name | 1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 14998085 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carbaldehyde |
| SMILES | Cc1nn(C)c(OCC(F)(F)F)c1C=O |
| InChI | InChI=1S/C8H9F3N2O2/c1-5-6(3-14)7(13(2)12-5)15-4-8(9,10)11/h3H,4H2,1-2H3 |
| InChIKey | IDUSRUSDBWEITC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|