About 1,4-dimethyl-1,4-diazepan-6-amine
1,4-dimethyl-1,4-diazepan-6-amine (PubChem CID 14999039) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol. Its IUPAC name is 1,4-dimethyl-1,4-diazepan-6-amine.
Molecular Properties
| Compound Name | 1,4-dimethyl-1,4-diazepan-6-amine |
| PubChem CID | 14999039 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 1,4-dimethyl-1,4-diazepan-6-amine |
| SMILES | CN1CCN(C)CC(N)C1 |
| InChI | InChI=1S/C7H17N3/c1-9-3-4-10(2)6-7(8)5-9/h7H,3-6,8H2,1-2H3 |
| InChIKey | RWICYHQFRMCCEX-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dimethyl-1,4-diazepan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-1,4-diazepan-6-amine?
The IUPAC name of 1,4-dimethyl-1,4-diazepan-6-amine (CID 14999039) is 1,4-dimethyl-1,4-diazepan-6-amine.
What is the SMILES notation for 1,4-dimethyl-1,4-diazepan-6-amine?
The canonical SMILES for 1,4-dimethyl-1,4-diazepan-6-amine is CN1CCN(C)CC(N)C1.
What is the InChIKey of 1,4-dimethyl-1,4-diazepan-6-amine?
The InChIKey is RWICYHQFRMCCEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3/c1-9-3-4-10(2)6-7(8)5-9/h7H,3-6,8H2,1-2H3.
What are the key properties of 1,4-dimethyl-1,4-diazepan-6-amine?
1,4-dimethyl-1,4-diazepan-6-amine has a molecular weight of 143.23 g/mol, XLogP of -0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-1,4-diazepan-6-amine is sourced from PubChem (CID 14999039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).