C22H33N7O4 — CID 14999606
(2S)-1-acetyl-N-[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 14999606) has the molecular formula C22H33N7O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is (2S)-1-acetyl-N-[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-acetyl-N-[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 14999606 |
| Molecular Formula | C22H33N7O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (2S)-1-acetyl-N-[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C22H33N7O4/c1-14(30)29-12-6-10-18(29)21(33)28-17(13-15-7-3-2-4-8-15)20(32)27-16(19(23)31)9-5-11-26-22(24)25/h2-4,7-8,16-18H,5-6,9-13H2,1H3,(H2,23,31)(H,27,32)(H,28,33)(H4,24,25,26)/t16-,17-,18-/m0/s1 |
| InChIKey | BVRBTAJCMBNWCB-BZSNNMDCSA-N |
| XLogP | -1.25 |
| TPSA | 186.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|