About [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol
[3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol (PubChem CID 14999834) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol |
| PubChem CID | 14999834 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol |
| SMILES | Nc1ncc(Cc2cc(CO)cc(CO)c2)c(N)n1 |
| InChI | InChI=1S/C13H16N4O2/c14-12-11(5-16-13(15)17-12)4-8-1-9(6-18)3-10(2-8)7-19/h1-3,5,18-19H,4,6-7H2,(H4,14,15,16,17) |
| InChIKey | LDJJOBOSGIJBCF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol?
The IUPAC name of [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol (CID 14999834) is [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol.
What is the SMILES notation for [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol?
The canonical SMILES for [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol is Nc1ncc(Cc2cc(CO)cc(CO)c2)c(N)n1.
What is the InChIKey of [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol?
The InChIKey is LDJJOBOSGIJBCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c14-12-11(5-16-13(15)17-12)4-8-1-9(6-18)3-10(2-8)7-19/h1-3,5,18-19H,4,6-7H2,(H4,14,15,16,17).
What are the key properties of [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol?
[3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol has a molecular weight of 260.30 g/mol, XLogP of 0.22, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,4-diaminopyrimidin-5-yl)methyl]-5-(hydroxymethyl)phenyl]methanol is sourced from PubChem (CID 14999834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).