C11H11FN4 — CID 14999835
5-[(4-fluorophenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 14999835) has the molecular formula C11H11FN4 and a molecular weight of 218.24 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(4-fluorophenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 14999835 |
| Molecular Formula | C11H11FN4 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Cc2ccc(F)cc2)c(N)n1 |
| InChI | InChI=1S/C11H11FN4/c12-9-3-1-7(2-4-9)5-8-6-15-11(14)16-10(8)13/h1-4,6H,5H2,(H4,13,14,15,16) |
| InChIKey | CYWWLUGRQFFCDK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |