About N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide
N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide (PubChem CID 14999847) has the molecular formula C13H15N5O
and a molecular weight of 257.30 g/mol. Its IUPAC name is N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide |
| PubChem CID | 14999847 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Cc2cnc(N)nc2N)cc1 |
| InChI | InChI=1S/C13H15N5O/c1-8(19)17-11-4-2-9(3-5-11)6-10-7-16-13(15)18-12(10)14/h2-5,7H,6H2,1H3,(H,17,19)(H4,14,15,16,18) |
| InChIKey | QROBKDOXPSLZLP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide?
The IUPAC name of N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide (CID 14999847) is N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide?
The canonical SMILES for N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide is CC(=O)Nc1ccc(Cc2cnc(N)nc2N)cc1.
What is the InChIKey of N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide?
The InChIKey is QROBKDOXPSLZLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O/c1-8(19)17-11-4-2-9(3-5-11)6-10-7-16-13(15)18-12(10)14/h2-5,7H,6H2,1H3,(H,17,19)(H4,14,15,16,18).
What are the key properties of N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide?
N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide has a molecular weight of 257.30 g/mol, XLogP of 1.19, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]acetamide is sourced from PubChem (CID 14999847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).