About N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide
N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide (PubChem CID 14999851) has the molecular formula C13H14N6O3
and a molecular weight of 302.29 g/mol. Its IUPAC name is N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide |
| PubChem CID | 14999851 |
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Cc2cnc(N)nc2N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N6O3/c1-7(20)17-10-3-2-8(5-11(10)19(21)22)4-9-6-16-13(15)18-12(9)14/h2-3,5-6H,4H2,1H3,(H,17,20)(H4,14,15,16,18) |
| InChIKey | AKHBBXPUWYDYHT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide?
The IUPAC name of N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide (CID 14999851) is N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide.
What is the SMILES notation for N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide?
The canonical SMILES for N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide is CC(=O)Nc1ccc(Cc2cnc(N)nc2N)cc1[N+](=O)[O-].
What is the InChIKey of N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide?
The InChIKey is AKHBBXPUWYDYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N6O3/c1-7(20)17-10-3-2-8(5-11(10)19(21)22)4-9-6-16-13(15)18-12(9)14/h2-3,5-6H,4H2,1H3,(H,17,20)(H4,14,15,16,18).
What are the key properties of N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide?
N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide has a molecular weight of 302.29 g/mol, XLogP of 1.10, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-nitrophenyl]acetamide is sourced from PubChem (CID 14999851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).