C22H30ClNO3 — CID 15000
diethyl-[2-(2-methoxy-2,2-diphenylacetyl)oxypropyl]azanium chloride (PubChem CID 15000) has the molecular formula C22H30ClNO3 and a molecular weight of 391.94 g/mol. Its IUPAC name is diethyl-[2-(2-methoxy-2,2-diphenylacetyl)oxypropyl]azanium chloride.
| Compound Name | diethyl-[2-(2-methoxy-2,2-diphenylacetyl)oxypropyl]azanium chloride |
|---|---|
| PubChem CID | 15000 |
| Molecular Formula | C22H30ClNO3 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | diethyl-[2-(2-methoxy-2,2-diphenylacetyl)oxypropyl]azanium chloride |
| SMILES | CC[NH+](CC)CC(C)OC(=O)C(OC)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H29NO3.ClH/c1-5-23(6-2)17-18(3)26-21(24)22(25-4,19-13-9-7-10-14-19)20-15-11-8-12-16-20;/h7-16,18H,5-6,17H2,1-4H3;1H |
| InChIKey | YYBKYSOOOQALJU-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |