C14H19FO3 — CID 15000118
(2S,3R,5S,6R)-5-fluoro-2-methoxy-6-methyl-3-phenylmethoxyoxane (PubChem CID 15000118) has the molecular formula C14H19FO3 and a molecular weight of 254.30 g/mol. Its IUPAC name is (2S,3R,5S,6R)-5-fluoro-2-methoxy-6-methyl-3-phenylmethoxyoxane.
| Compound Name | (2S,3R,5S,6R)-5-fluoro-2-methoxy-6-methyl-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 15000118 |
| Molecular Formula | C14H19FO3 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2S,3R,5S,6R)-5-fluoro-2-methoxy-6-methyl-3-phenylmethoxyoxane |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](F)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H19FO3/c1-10-12(15)8-13(14(16-2)18-10)17-9-11-6-4-3-5-7-11/h3-7,10,12-14H,8-9H2,1-2H3/t10-,12+,13-,14+/m1/s1 |
| InChIKey | MXOHZKNSMSHPKW-CABNGKKXSA-N |
| XLogP | 2.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |