C12H15F5O4 — CID 150003529
(E)-4-oxo-4-(1,1,1,2,2-pentafluorooctan-4-yloxy)but-2-enoic acid (PubChem CID 150003529) has the molecular formula C12H15F5O4 and a molecular weight of 318.24 g/mol. Its IUPAC name is (E)-4-oxo-4-(1,1,1,2,2-pentafluorooctan-4-yloxy)but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-(1,1,1,2,2-pentafluorooctan-4-yloxy)but-2-enoic acid |
|---|---|
| PubChem CID | 150003529 |
| Molecular Formula | C12H15F5O4 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (E)-4-oxo-4-(1,1,1,2,2-pentafluorooctan-4-yloxy)but-2-enoic acid |
| SMILES | CCCCC(CC(F)(F)C(F)(F)F)OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H15F5O4/c1-2-3-4-8(7-11(13,14)12(15,16)17)21-10(20)6-5-9(18)19/h5-6,8H,2-4,7H2,1H3,(H,18,19)/b6-5+ |
| InChIKey | DBUKPAACDPIKFE-AATRIKPKSA-N |
| XLogP | 3.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|