About 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol
1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol (PubChem CID 150004194) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol |
| PubChem CID | 150004194 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol |
| SMILES | OCC1(O)CCC(Nc2ncncn2)C1 |
| InChI | InChI=1S/C9H14N4O2/c14-4-9(15)2-1-7(3-9)13-8-11-5-10-6-12-8/h5-7,14-15H,1-4H2,(H,10,11,12,13) |
| InChIKey | DBXYPBUMQHVSPQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol?
The IUPAC name of 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol (CID 150004194) is 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol.
What is the SMILES notation for 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol?
The canonical SMILES for 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol is OCC1(O)CCC(Nc2ncncn2)C1.
What is the InChIKey of 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol?
The InChIKey is DBXYPBUMQHVSPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2/c14-4-9(15)2-1-7(3-9)13-8-11-5-10-6-12-8/h5-7,14-15H,1-4H2,(H,10,11,12,13).
What are the key properties of 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol?
1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol has a molecular weight of 210.24 g/mol, XLogP of -0.44, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol is sourced from PubChem (CID 150004194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).