C23H32O6 — CID 15000515
trimethyl (1R,2S,3R,4R,8R,9R,12R)-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylate (PubChem CID 15000515) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is trimethyl (1R,2S,3R,4R,8R,9R,12R)-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylate.
| Compound Name | trimethyl (1R,2S,3R,4R,8R,9R,12R)-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylate |
|---|---|
| PubChem CID | 15000515 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | trimethyl (1R,2S,3R,4R,8R,9R,12R)-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylate |
| SMILES | C=C1C[C@]23C[C@H]1CC[C@H]2[C@]1(C(=O)OC)CCC[C@@](C)(C(=O)OC)[C@H]1[C@@H]3C(=O)OC |
| InChI | InChI=1S/C23H32O6/c1-13-11-22-12-14(13)7-8-15(22)23(20(26)29-5)10-6-9-21(2,19(25)28-4)17(23)16(22)18(24)27-3/h14-17H,1,6-12H2,2-5H3/t14-,15-,16-,17-,21-,22+,23-/m1/s1 |
| InChIKey | CVVOOYMCPNGYQG-BUYPHVAFSA-N |
| XLogP | 3.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|