About 4-(azidomethyl)-1,5-dimethylpyrazole
4-(azidomethyl)-1,5-dimethylpyrazole (PubChem CID 150005972) has the molecular formula C6H9N5
and a molecular weight of 151.17 g/mol. Its IUPAC name is 4-(azidomethyl)-1,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 4-(azidomethyl)-1,5-dimethylpyrazole |
| PubChem CID | 150005972 |
| Molecular Formula | C6H9N5 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | 4-(azidomethyl)-1,5-dimethylpyrazole |
| SMILES | Cc1c(CN=[N+]=[N-])cnn1C |
| InChI | InChI=1S/C6H9N5/c1-5-6(3-8-10-7)4-9-11(5)2/h4H,3H2,1-2H3 |
| InChIKey | DCGZWWWYFJAEQN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(azidomethyl)-1,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azidomethyl)-1,5-dimethylpyrazole?
The IUPAC name of 4-(azidomethyl)-1,5-dimethylpyrazole (CID 150005972) is 4-(azidomethyl)-1,5-dimethylpyrazole.
What is the SMILES notation for 4-(azidomethyl)-1,5-dimethylpyrazole?
The canonical SMILES for 4-(azidomethyl)-1,5-dimethylpyrazole is Cc1c(CN=[N+]=[N-])cnn1C.
What is the InChIKey of 4-(azidomethyl)-1,5-dimethylpyrazole?
The InChIKey is DCGZWWWYFJAEQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5/c1-5-6(3-8-10-7)4-9-11(5)2/h4H,3H2,1-2H3.
What are the key properties of 4-(azidomethyl)-1,5-dimethylpyrazole?
4-(azidomethyl)-1,5-dimethylpyrazole has a molecular weight of 151.17 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethyl)-1,5-dimethylpyrazole is sourced from PubChem (CID 150005972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).