C18H17N3O — CID 150009438
N-(6-methyl-1,7a-dihydroindolo[1,2-c]quinazolin-12-yl)acetamide (PubChem CID 150009438) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(6-methyl-1,7a-dihydroindolo[1,2-c]quinazolin-12-yl)acetamide.
| Compound Name | N-(6-methyl-1,7a-dihydroindolo[1,2-c]quinazolin-12-yl)acetamide |
|---|---|
| PubChem CID | 150009438 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-(6-methyl-1,7a-dihydroindolo[1,2-c]quinazolin-12-yl)acetamide |
| SMILES | CC(=O)NC1=C2C=CC=CC2N2C(C)=NC3=CC=CCC3=C12 |
| InChI | InChI=1S/C18H17N3O/c1-11-19-15-9-5-3-7-13(15)18-17(20-12(2)22)14-8-4-6-10-16(14)21(11)18/h3-6,8-10,16H,7H2,1-2H3,(H,20,22) |
| InChIKey | JVDYGOCWJQSNJP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |