About 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one
5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one (PubChem CID 150009461) has the molecular formula C20H21N5O
and a molecular weight of 347.42 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one.
Molecular Properties
| Compound Name | 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one |
| PubChem CID | 150009461 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one |
| SMILES | CN1CCN(C2=NN3C(=O)C4C=CC=CC4=NC3=C3C=CC=CC23)CC1 |
| InChI | InChI=1S/C20H21N5O/c1-23-10-12-24(13-11-23)19-15-7-3-2-6-14(15)18-21-17-9-5-4-8-16(17)20(26)25(18)22-19/h2-9,15-16H,10-13H2,1H3 |
| InChIKey | ZLTSJOJZAXTTDQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 51.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one?
The IUPAC name of 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one (CID 150009461) is 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one.
What is the SMILES notation for 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one?
The canonical SMILES for 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one is CN1CCN(C2=NN3C(=O)C4C=CC=CC4=NC3=C3C=CC=CC23)CC1.
What is the InChIKey of 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one?
The InChIKey is ZLTSJOJZAXTTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N5O/c1-23-10-12-24(13-11-23)19-15-7-3-2-6-14(15)18-21-17-9-5-4-8-16(17)20(26)25(18)22-19/h2-9,15-16H,10-13H2,1H3.
What are the key properties of 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one?
5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one has a molecular weight of 347.42 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylpiperazin-1-yl)-4a,8a-dihydroquinazolino[2,3-a]phthalazin-8-one is sourced from PubChem (CID 150009461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).