C24H23BClFN4O10 — CID 150009661
(3R)-3-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 150009661) has the molecular formula C24H23BClFN4O10 and a molecular weight of 592.73 g/mol. Its IUPAC name is (3R)-3-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 150009661 |
| Molecular Formula | C24H23BClFN4O10 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | (3R)-3-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1OB(O)[C@@H](NC(=O)C(NC(=O)N1CCN(CCF)C(=O)C1=O)c1ccc(O)c(O)c1Cl)C2 |
| InChI | InChI=1S/C24H23BClFN4O10/c26-16-12(4-5-14(32)18(16)33)17(29-24(39)31-9-8-30(7-6-27)21(35)22(31)36)20(34)28-15-10-11-2-1-3-13(23(37)38)19(11)41-25(15)40/h1-5,15,17,32-33,40H,6-10H2,(H,28,34)(H,29,39)(H,37,38)/t15-,17?/m0/s1 |
| InChIKey | DCZZOFGWNPABIV-MYJWUSKBSA-N |
| XLogP | -0.02 |
| TPSA | 206.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|