About 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane
5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane (PubChem CID 150009891) has the molecular formula C22H42O
and a molecular weight of 322.58 g/mol. Its IUPAC name is 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane.
Molecular Properties
| Compound Name | 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane |
| PubChem CID | 150009891 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane |
| SMILES | C=CC(C=C)(OC(C)(C)C)C(CCCC)CCCCCCCC |
| InChI | InChI=1S/C22H42O/c1-8-12-14-15-16-17-19-20(18-13-9-2)22(10-3,11-4)23-21(5,6)7/h10-11,20H,3-4,8-9,12-19H2,1-2,5-7H3 |
| InChIKey | DDAZQTFWNOCRQD-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane?
The IUPAC name of 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane (CID 150009891) is 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane.
What is the SMILES notation for 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane?
The canonical SMILES for 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane is C=CC(C=C)(OC(C)(C)C)C(CCCC)CCCCCCCC.
What is the InChIKey of 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane?
The InChIKey is DDAZQTFWNOCRQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O/c1-8-12-14-15-16-17-19-20(18-13-9-2)22(10-3,11-4)23-21(5,6)7/h10-11,20H,3-4,8-9,12-19H2,1-2,5-7H3.
What are the key properties of 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane?
5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane has a molecular weight of 322.58 g/mol, XLogP of 7.47, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(2-methylpropan-2-yl)oxy]penta-1,4-dien-3-yl]tridecane is sourced from PubChem (CID 150009891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).