About 2-phenyl-2H-pyran;titanium
2-phenyl-2H-pyran;titanium (PubChem CID 150010231) has the molecular formula C11H9OTi-
and a molecular weight of 205.06 g/mol. Its IUPAC name is 2-phenyl-2H-pyran;titanium.
Molecular Properties
| Compound Name | 2-phenyl-2H-pyran;titanium |
| PubChem CID | 150010231 |
| Molecular Formula | C11H9OTi- |
| Molecular Weight | 205.06 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 2-phenyl-2H-pyran;titanium |
| SMILES | [Ti].[c-]1cccc(C2C=CC=CO2)c1 |
| InChI | InChI=1S/C11H9O.Ti/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-2,4-9,11H;/q-1; |
| InChIKey | AIOIDCFJKNLBOV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.06 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-2H-pyran;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2H-pyran;titanium?
The IUPAC name of 2-phenyl-2H-pyran;titanium (CID 150010231) is 2-phenyl-2H-pyran;titanium.
What is the SMILES notation for 2-phenyl-2H-pyran;titanium?
The canonical SMILES for 2-phenyl-2H-pyran;titanium is [Ti].[c-]1cccc(C2C=CC=CO2)c1.
What is the InChIKey of 2-phenyl-2H-pyran;titanium?
The InChIKey is AIOIDCFJKNLBOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9O.Ti/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-2,4-9,11H;/q-1;.
What are the key properties of 2-phenyl-2H-pyran;titanium?
2-phenyl-2H-pyran;titanium has a molecular weight of 205.06 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2H-pyran;titanium is sourced from PubChem (CID 150010231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).