C22H24F3N5O2 — CID 150011955
6-cyclopropyl-3-(4,4-dimethyl-2-oxopyrrolidin-1-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide (PubChem CID 150011955) has the molecular formula C22H24F3N5O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is 6-cyclopropyl-3-(4,4-dimethyl-2-oxopyrrolidin-1-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide.
| Compound Name | 6-cyclopropyl-3-(4,4-dimethyl-2-oxopyrrolidin-1-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 150011955 |
| Molecular Formula | C22H24F3N5O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 6-cyclopropyl-3-(4,4-dimethyl-2-oxopyrrolidin-1-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
| SMILES | CC1(C)CC(=O)N(c2cnn3c2CN(C(=O)Nc2cc(F)c(F)c(F)c2)C(C2CC2)C3)C1 |
| InChI | InChI=1S/C22H24F3N5O2/c1-22(2)7-19(31)29(11-22)16-8-26-30-10-17(12-3-4-12)28(9-18(16)30)21(32)27-13-5-14(23)20(25)15(24)6-13/h5-6,8,12,17H,3-4,7,9-11H2,1-2H3,(H,27,32) |
| InChIKey | DDLSZAVXOXKJMZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|