About octyl 3,3-dichloroprop-2-enoate
octyl 3,3-dichloroprop-2-enoate (PubChem CID 15001319) has the molecular formula C11H18Cl2O2
and a molecular weight of 253.17 g/mol. Its IUPAC name is octyl 3,3-dichloroprop-2-enoate.
Molecular Properties
| Compound Name | octyl 3,3-dichloroprop-2-enoate |
| PubChem CID | 15001319 |
| Molecular Formula | C11H18Cl2O2 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | octyl 3,3-dichloroprop-2-enoate |
| SMILES | CCCCCCCCOC(=O)C=C(Cl)Cl |
| InChI | InChI=1S/C11H18Cl2O2/c1-2-3-4-5-6-7-8-15-11(14)9-10(12)13/h9H,2-8H2,1H3 |
| InChIKey | JRZDJDCFMWEWNV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze octyl 3,3-dichloroprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 3,3-dichloroprop-2-enoate?
The IUPAC name of octyl 3,3-dichloroprop-2-enoate (CID 15001319) is octyl 3,3-dichloroprop-2-enoate.
What is the SMILES notation for octyl 3,3-dichloroprop-2-enoate?
The canonical SMILES for octyl 3,3-dichloroprop-2-enoate is CCCCCCCCOC(=O)C=C(Cl)Cl.
What is the InChIKey of octyl 3,3-dichloroprop-2-enoate?
The InChIKey is JRZDJDCFMWEWNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18Cl2O2/c1-2-3-4-5-6-7-8-15-11(14)9-10(12)13/h9H,2-8H2,1H3.
What are the key properties of octyl 3,3-dichloroprop-2-enoate?
octyl 3,3-dichloroprop-2-enoate has a molecular weight of 253.17 g/mol, XLogP of 4.21, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 3,3-dichloroprop-2-enoate is sourced from PubChem (CID 15001319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).