C23H23BrF2N4OSi — CID 150015339
2-[[4-(7-bromo-1,5-naphthyridin-2-yl)-5-(3,4-difluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 150015339) has the molecular formula C23H23BrF2N4OSi and a molecular weight of 517.45 g/mol. Its IUPAC name is 2-[[4-(7-bromo-1,5-naphthyridin-2-yl)-5-(3,4-difluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(7-bromo-1,5-naphthyridin-2-yl)-5-(3,4-difluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 150015339 |
| Molecular Formula | C23H23BrF2N4OSi |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 2-[[4-(7-bromo-1,5-naphthyridin-2-yl)-5-(3,4-difluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc(-c2ccc3ncc(Br)cc3n2)c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H23BrF2N4OSi/c1-32(2,3)9-8-31-14-30-13-28-22(23(30)15-4-5-17(25)18(26)10-15)20-7-6-19-21(29-20)11-16(24)12-27-19/h4-7,10-13H,8-9,14H2,1-3H3 |
| InChIKey | DEDINGJMUNUAKY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|