C17H16F4 — CID 15001656
1,2,4,5-tetrafluoro-3-(4-pentylphenyl)benzene (PubChem CID 15001656) has the molecular formula C17H16F4 and a molecular weight of 296.31 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-(4-pentylphenyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 15001656 |
| Molecular Formula | C17H16F4 |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C17H16F4/c1-2-3-4-5-11-6-8-12(9-7-11)15-16(20)13(18)10-14(19)17(15)21/h6-10H,2-5H2,1H3 |
| InChIKey | CZUSJDMIGFFYDR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|