C9H5ClF8N2 — CID 15001668
6-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)pyridin-3-amine (PubChem CID 15001668) has the molecular formula C9H5ClF8N2 and a molecular weight of 328.59 g/mol. Its IUPAC name is 6-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)pyridin-3-amine.
| Compound Name | 6-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)pyridin-3-amine |
|---|---|
| PubChem CID | 15001668 |
| Molecular Formula | C9H5ClF8N2 |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 6-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)pyridin-3-amine |
| SMILES | Nc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)nc1 |
| InChI | InChI=1S/C9H5ClF8N2/c10-9(17,18)8(15,16)7(13,14)6(11,12)5-2-1-4(19)3-20-5/h1-3H,19H2 |
| InChIKey | JFYTUBQWJYBNAX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|