About 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one
3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one (PubChem CID 15001686) has the molecular formula C10H13IO3
and a molecular weight of 308.12 g/mol. Its IUPAC name is 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one.
Molecular Properties
| Compound Name | 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
| PubChem CID | 15001686 |
| Molecular Formula | C10H13IO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
| SMILES | CC1=C(I)C(=O)OC2(CCCCC2)O1 |
| InChI | InChI=1S/C10H13IO3/c1-7-8(11)9(12)14-10(13-7)5-3-2-4-6-10/h2-6H2,1H3 |
| InChIKey | OYJHKBGBPQQBNC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one?
The IUPAC name of 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one (CID 15001686) is 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one.
What is the SMILES notation for 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one?
The canonical SMILES for 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one is CC1=C(I)C(=O)OC2(CCCCC2)O1.
What is the InChIKey of 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one?
The InChIKey is OYJHKBGBPQQBNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IO3/c1-7-8(11)9(12)14-10(13-7)5-3-2-4-6-10/h2-6H2,1H3.
What are the key properties of 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one?
3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one has a molecular weight of 308.12 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2-methyl-1,5-dioxaspiro[5.5]undec-2-en-4-one is sourced from PubChem (CID 15001686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).