C5H5FN2O4 — CID 15001719
5-fluoro-5-methoxy-1,3-diazinane-2,4,6-trione (PubChem CID 15001719) has the molecular formula C5H5FN2O4 and a molecular weight of 176.10 g/mol. Its IUPAC name is 5-fluoro-5-methoxy-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-fluoro-5-methoxy-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15001719 |
| Molecular Formula | C5H5FN2O4 |
| Molecular Weight | 176.10 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 5-fluoro-5-methoxy-1,3-diazinane-2,4,6-trione |
| SMILES | COC1(F)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C5H5FN2O4/c1-12-5(6)2(9)7-4(11)8-3(5)10/h1H3,(H2,7,8,9,10,11) |
| InChIKey | HERHIMRTTVAEBA-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.10 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|