C12H20F6NO5P — CID 15001729
ethyl N-(2-dipropoxyphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate (PubChem CID 15001729) has the molecular formula C12H20F6NO5P and a molecular weight of 403.26 g/mol. Its IUPAC name is ethyl N-(2-dipropoxyphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate.
| Compound Name | ethyl N-(2-dipropoxyphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
|---|---|
| PubChem CID | 15001729 |
| Molecular Formula | C12H20F6NO5P |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl N-(2-dipropoxyphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
| SMILES | CCCOP(=O)(OCCC)C(NC(=O)OCC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H20F6NO5P/c1-4-7-23-25(21,24-8-5-2)10(11(13,14)15,12(16,17)18)19-9(20)22-6-3/h4-8H2,1-3H3,(H,19,20) |
| InChIKey | BVIPOJFIWRLOCH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|