C23H14Cl6N4 — CID 15001921
4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline (PubChem CID 15001921) has the molecular formula C23H14Cl6N4 and a molecular weight of 559.11 g/mol. Its IUPAC name is 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 15001921 |
| Molecular Formula | C23H14Cl6N4 |
| Molecular Weight | 559.11 g/mol |
| Exact Mass | 555.93 |
| IUPAC Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline |
| SMILES | ClC(Cl)(Cl)c1nc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C23H14Cl6N4/c24-22(25,26)20-30-19(31-21(32-20)23(27,28)29)15-11-13-18(14-12-15)33(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H |
| InChIKey | IMGUTCMQQXOLTP-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.11 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|