C19H12Cl6N4O2 — CID 15001925
N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-4-methoxybenzamide (PubChem CID 15001925) has the molecular formula C19H12Cl6N4O2 and a molecular weight of 541.05 g/mol. Its IUPAC name is N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 15001925 |
| Molecular Formula | C19H12Cl6N4O2 |
| Molecular Weight | 541.05 g/mol |
| Exact Mass | 537.91 |
| IUPAC Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)cc2)cc1 |
| InChI | InChI=1S/C19H12Cl6N4O2/c1-31-13-8-4-11(5-9-13)15(30)26-12-6-2-10(3-7-12)14-27-16(18(20,21)22)29-17(28-14)19(23,24)25/h2-9H,1H3,(H,26,30) |
| InChIKey | QVFZCKXIGRYZSZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.05 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|