About 1,4-dioxane-2,3-dicarbaldehyde
1,4-dioxane-2,3-dicarbaldehyde (PubChem CID 150021643) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 1,4-dioxane-2,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 1,4-dioxane-2,3-dicarbaldehyde |
| PubChem CID | 150021643 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 1,4-dioxane-2,3-dicarbaldehyde |
| SMILES | O=CC1OCCOC1C=O |
| InChI | InChI=1S/C6H8O4/c7-3-5-6(4-8)10-2-1-9-5/h3-6H,1-2H2 |
| InChIKey | DFJKZJNOFVAONZ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioxane-2,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane-2,3-dicarbaldehyde?
The IUPAC name of 1,4-dioxane-2,3-dicarbaldehyde (CID 150021643) is 1,4-dioxane-2,3-dicarbaldehyde.
What is the SMILES notation for 1,4-dioxane-2,3-dicarbaldehyde?
The canonical SMILES for 1,4-dioxane-2,3-dicarbaldehyde is O=CC1OCCOC1C=O.
What is the InChIKey of 1,4-dioxane-2,3-dicarbaldehyde?
The InChIKey is DFJKZJNOFVAONZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c7-3-5-6(4-8)10-2-1-9-5/h3-6H,1-2H2.
What are the key properties of 1,4-dioxane-2,3-dicarbaldehyde?
1,4-dioxane-2,3-dicarbaldehyde has a molecular weight of 144.13 g/mol, XLogP of -0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane-2,3-dicarbaldehyde is sourced from PubChem (CID 150021643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).