About (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide
(3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide (PubChem CID 150023035) has the molecular formula C8H16F2N2O2
and a molecular weight of 210.22 g/mol. Its IUPAC name is (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide.
Molecular Properties
| Compound Name | (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide |
| PubChem CID | 150023035 |
| Molecular Formula | C8H16F2N2O2 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide |
| SMILES | CCC[C@](N)(O)C(F)(F)C(=O)N(C)C |
| InChI | InChI=1S/C8H16F2N2O2/c1-4-5-7(11,14)8(9,10)6(13)12(2)3/h14H,4-5,11H2,1-3H3/t7-/m0/s1 |
| InChIKey | DFQRDFIXBYBSIA-ZETCQYMHSA-N |
| XLogP | 0.16 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide?
The IUPAC name of (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide (CID 150023035) is (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide.
What is the SMILES notation for (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide?
The canonical SMILES for (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide is CCC[C@](N)(O)C(F)(F)C(=O)N(C)C.
What is the InChIKey of (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide?
The InChIKey is DFQRDFIXBYBSIA-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H16F2N2O2/c1-4-5-7(11,14)8(9,10)6(13)12(2)3/h14H,4-5,11H2,1-3H3/t7-/m0/s1.
What are the key properties of (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide?
(3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide has a molecular weight of 210.22 g/mol, XLogP of 0.16, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-2,2-difluoro-3-hydroxy-N,N-dimethylhexanamide is sourced from PubChem (CID 150023035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).