About [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate
[(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate (PubChem CID 150023504) has the molecular formula C17H24INO4
and a molecular weight of 433.29 g/mol. Its IUPAC name is [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate.
Molecular Properties
| Compound Name | [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate |
| PubChem CID | 150023504 |
| Molecular Formula | C17H24INO4 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate |
| SMILES | COCOC(CC(C)C)(c1ccccc1I)[C@H]1C[C@@H]1OC(N)=O |
| InChI | InChI=1S/C17H24INO4/c1-11(2)9-17(22-10-21-3,12-6-4-5-7-14(12)18)13-8-15(13)23-16(19)20/h4-7,11,13,15H,8-10H2,1-3H3,(H2,19,20)/t13-,15-,17?/m0/s1 |
| InChIKey | DFTFMOVBATUOTK-JENVPCQVSA-N |
| XLogP | 3.64 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate?
The IUPAC name of [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate (CID 150023504) is [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate.
What is the SMILES notation for [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate?
The canonical SMILES for [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate is COCOC(CC(C)C)(c1ccccc1I)[C@H]1C[C@@H]1OC(N)=O.
What is the InChIKey of [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate?
The InChIKey is DFTFMOVBATUOTK-JENVPCQVSA-N. The full InChI is InChI=1S/C17H24INO4/c1-11(2)9-17(22-10-21-3,12-6-4-5-7-14(12)18)13-8-15(13)23-16(19)20/h4-7,11,13,15H,8-10H2,1-3H3,(H2,19,20)/t13-,15-,17?/m0/s1.
What are the key properties of [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate?
[(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate has a molecular weight of 433.29 g/mol, XLogP of 3.64, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-[1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutyl]cyclopropyl] carbamate is sourced from PubChem (CID 150023504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).